CymitQuimica logo

CAS 1003944-36-2

:

2,7-Dimethoxy-1,5-naphthyridine

Description:
2,7-Dimethoxy-1,5-naphthyridine is a heterocyclic organic compound characterized by its naphthyridine structure, which consists of a fused bicyclic system containing nitrogen atoms. This compound features two methoxy groups (-OCH3) located at the 2 and 7 positions of the naphthyridine ring, which can influence its chemical reactivity and solubility. The presence of these methoxy substituents typically enhances the compound's lipophilicity and may affect its biological activity. 2,7-Dimethoxy-1,5-naphthyridine is of interest in medicinal chemistry due to its potential pharmacological properties, including antimicrobial and anticancer activities. The compound's molecular structure allows for various synthetic modifications, making it a valuable intermediate in the development of new therapeutic agents. Additionally, its stability and reactivity can be influenced by factors such as pH and the presence of other functional groups. Overall, 2,7-Dimethoxy-1,5-naphthyridine represents a significant compound in the study of heterocyclic chemistry and its applications in drug discovery.
Formula:C10H10N2O2
InChI:InChI=1S/C10H10N2O2/c1-13-7-5-9-8(11-6-7)3-4-10(12-9)14-2/h3-6H,1-2H3
InChI key:InChIKey=RYQMVLSBVFPJHP-UHFFFAOYSA-N
SMILES:O(C)C1=CC2=C(C=CC(OC)=N2)N=C1
Synonyms:
  • 2,7-Bis(methyloxy)-1,5-naphthyridine
  • 1,5-Naphthyridine, 2,7-dimethoxy-
  • 2,7-Dimethoxy-1,5-naphthyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.