CAS 100399-51-7
:(10E)-11-bromoundec-10-enoic acid
Description:
(10E)-11-bromoundec-10-enoic acid is an unsaturated fatty acid characterized by the presence of a bromine atom and a double bond in its carbon chain. The "10E" designation indicates that the double bond between the 10th and 11th carbon atoms is in the trans configuration, which can influence the compound's physical and chemical properties, such as its melting point and reactivity. This compound features a long hydrocarbon chain, typical of fatty acids, which contributes to its hydrophobic characteristics, while the carboxylic acid functional group (-COOH) at one end makes it polar and capable of forming hydrogen bonds. The presence of the bromine atom introduces a halogen, which can enhance the compound's reactivity, particularly in substitution reactions. Such characteristics make (10E)-11-bromoundec-10-enoic acid of interest in various chemical applications, including organic synthesis and potentially in the development of pharmaceuticals or agrochemicals. Its unique structure may also influence its biological activity and interactions with other molecules.
Formula:C11H19BrO2
InChI:InChI=1/C11H19BrO2/c12-10-8-6-4-2-1-3-5-7-9-11(13)14/h8,10H,1-7,9H2,(H,13,14)/b10-8+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.