
CAS 1003993-44-9
:1-[(2-Fluorophenoxy)methyl]-3-nitro-1H-pyrazole
Description:
1-[(2-Fluorophenoxy)methyl]-3-nitro-1H-pyrazole is a chemical compound characterized by its unique molecular structure, which includes a pyrazole ring substituted with a nitro group and a phenoxy group containing a fluorine atom. This compound typically exhibits moderate to high polarity due to the presence of the nitro and fluorine substituents, which can influence its solubility in various solvents. The fluorine atom enhances the compound's lipophilicity, potentially affecting its biological activity and interaction with other molecules. The nitro group is known for its electron-withdrawing properties, which can impact the reactivity of the pyrazole moiety. This compound may be of interest in medicinal chemistry, particularly for its potential applications in pharmaceuticals or agrochemicals. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the electronic effects of the substituents. Safety data and handling precautions should be considered due to the presence of the nitro group, which can pose hazards in certain conditions.
Formula:C10H8FN3O3
InChI:InChI=1S/C10H8FN3O3/c11-8-3-1-2-4-9(8)17-7-13-6-5-10(12-13)14(15)16/h1-6H,7H2
InChI key:InChIKey=OMKLRJWVPTXFHW-UHFFFAOYSA-N
SMILES:C(OC1=C(F)C=CC=C1)N2N=C(N(=O)=O)C=C2
Synonyms:- 1-[(2-Fluorophenoxy)methyl]-3-nitro-1H-pyrazole
- 1H-Pyrazole, 1-[(2-fluorophenoxy)methyl]-3-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.