CAS 1004-24-6: 4-Methylenecyclohexanemethanol

Description:4-Methylenecyclohexanemethanol, with the CAS number 1004-24-6, is an organic compound characterized by its unique structure, which includes a cyclohexane ring with a methylene bridge and a hydroxymethyl group. This compound is typically a colorless to pale yellow liquid at room temperature and exhibits moderate solubility in water, influenced by the presence of the hydroxymethyl group. Its molecular structure contributes to its reactivity, particularly in organic synthesis, where it can participate in various chemical reactions such as nucleophilic substitutions and polymerizations. The compound may also exhibit interesting physical properties, including a specific boiling point and density, which are relevant for applications in chemical manufacturing and research. Additionally, 4-Methylenecyclohexanemethanol can serve as an intermediate in the synthesis of more complex organic molecules, making it valuable in the development of pharmaceuticals and other chemical products. Safety data should be consulted to understand its handling and potential hazards in laboratory settings.

Formula:C₈H₁₄O

InChI:InChI=1S/C8H14O/c1-7-2-4-8(6-9)5-3-7/h8-9H,1-6H2

InChI key:InChIKey=VEDQBZWFMDUFHU-UHFFFAOYSA-N

SMILES:OCC1CCC(=C)CC1

Synonyms:
(4-Methylidenecyclohexyl)Methanol
1-Hydroxymethly-4-methylenecyclohexane
4-Methylenecyclohexanemethanol
Cyclohexanemethanol, 4-methylene
4-Methylenecyclohexylmethanol

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Cyclohexanemethanol, 4-methylene- REF: IN-DA0001X4CAS: 1004-24-6	95%	To inquire	Tue 04 Mar 25
(4-Methylidenecyclohexyl)methanol REF: 54-OR76632CAS: 1004-24-6	98+%	52.00 €~3,455.00 €	Mon 03 Mar 25
(4-METHYLIDENECYCLOHEXYL)METHANOL REF: 10-F513043CAS: 1004-24-6	95.0%	78.00 €~715.00 €	Wed 05 Mar 25
(4-Methylenecyclohexyl)methanol REF: 3D-BAA00424CAS: 1004-24-6	Min. 95%	To inquire	Tue 15 Apr 25