CAS 1004-24-6

4-Methylenecyclohexanemethanol

Description:

4-Methylenecyclohexanemethanol, with the CAS number 1004-24-6, is an organic compound characterized by its unique structure, which includes a cyclohexane ring with a methylene bridge and a hydroxymethyl group. This compound is typically a colorless to pale yellow liquid at room temperature and exhibits moderate solubility in water, influenced by the presence of the hydroxymethyl group. Its molecular structure contributes to its reactivity, particularly in organic synthesis, where it can participate in various chemical reactions such as nucleophilic substitutions and polymerizations. The compound may also exhibit interesting physical properties, including a specific boiling point and density, which are relevant for applications in chemical manufacturing and research. Additionally, 4-Methylenecyclohexanemethanol can serve as an intermediate in the synthesis of more complex organic molecules, making it valuable in the development of pharmaceuticals and other chemical products. Safety data should be consulted to understand its handling and potential hazards in laboratory settings.

Formula: C₈H₁₄O

InChI: InChI=1S/C8H14O/c1-7-2-4-8(6-9)5-3-7/h8-9H,1-6H2

InChI key: InChIKey=VEDQBZWFMDUFHU-UHFFFAOYSA-N

SMILES: C(O)C1CCC(=C)CC1

Synonyms:

• (4-Methylidenecyclohexyl)Methanol
• 1-Hydroxymethly-4-methylenecyclohexane
• 4-Methylenecyclohexanemethanol
• Cyclohexanemethanol, 4-methylene
• 4-Methylenecyclohexylmethanol

Cyclohexanemethanol, 4-methylene-

CAS: 1004-24-6

Formula: C₈H₁₄O

Purity: 97%

Color and Shape: Liquid

Molecular weight: 126.1962

Ref: IN-DA0001X4

(4-Methylidenecyclohexyl)methanol

CAS: 1004-24-6

(4-Methylidenecyclohexyl)methanol

Purity: 98%

Molecular weight: 126.20g/mol

Ref: 54-OR76632

(4-METHYLIDENECYCLOHEXYL)METHANOL

CAS: 1004-24-6

Formula: C₈H₁₄O

Purity: 97%

Molecular weight: 126.199

Ref: 10-F513043

(4-Methylenecyclohexyl)methanol

CAS: 1004-24-6

(4-Methylenecyclohexyl)methanol is a high-boiling liquid that is used as a solvent for various organic reactions. It is prepared by the oxymercuration of 4-methylcyclohexanol in the presence of tert-butyl alcohol and borohydride. The reaction proceeds with the formation of tert-butyl (4-methylenecyclohexyl) ether, which is hydrolyzed to give (4-methylenecyclohexyl)methanol. This intermediate can be further reduced with borohydride to yield tert-butyl alcohol.

Formula: C₈H₁₄O

Purity: Min. 95%

Molecular weight: 126.2 g/mol

Ref: 3D-BAA00424