CAS 1004-74-6
:Tetraaminopyrimidine
Description:
Tetraaminopyrimidine, with the CAS number 1004-74-6, is an organic compound characterized by its pyrimidine ring structure, which is substituted with four amino groups. This compound typically appears as a white to off-white crystalline solid. Tetraaminopyrimidine is known for its potential applications in various fields, including pharmaceuticals and biochemistry, due to its ability to act as a building block for more complex molecules. It exhibits basic properties due to the presence of amino groups, which can participate in hydrogen bonding and protonation reactions. The compound is soluble in polar solvents, which enhances its reactivity and interaction with other chemical species. Additionally, tetraaminopyrimidine may exhibit biological activity, making it of interest in medicinal chemistry. However, handling this compound requires caution, as with many amines, due to potential toxicity and reactivity. Overall, tetraaminopyrimidine is a versatile compound with significant implications in chemical research and development.
Formula:C4H8N6
InChI:InChI=1S/C4H8N6/c5-1-2(6)9-4(8)10-3(1)7/h5H2,(H6,6,7,8,9,10)
InChI key:InChIKey=PZRKPUQWIFJRKZ-UHFFFAOYSA-N
SMILES:NC=1C(N)=NC(N)=NC1N
Synonyms:- 2,4,5,6-Pyrimidinetetramine
- 2,4,5,6-Tetraaminopyrimidine sulphate monohydrate
- Brn 0144442
- Pyrimidine, 2,4,5,6-tetraamino-
- Pyrimidine, tetraamino-
- Pyrimidine-2,4,5,6-Tetramine
- Pyrimidine-2,4,5,6-Tetramine Sulfate Hydrate
- Pyrimidinetetramine
- Tetraaminopyrimidine
- 2,4,5,6-Tetraaminopyrimidine
- 5-25-12-00377 (Beilstein Handbook Reference)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,4,5,6-Pyrimidinetetramine
CAS:Formula:C4H8N6Purity:95%Color and Shape:SolidMolecular weight:140.14652,4,5,6-Tetraaminopyrimidine
CAS:2,4,5,6-Tetraaminopyrimidine is an aminophenol with a chlorine substituent. It is used in the synthesis of a variety of compounds that are used in the production of cosmetics and pharmaceuticals. 2,4,5,6-Tetraaminopyrimidine can be reduced to produce 2,4-dichlorobenzene by hydrogenation or reacted with an acid to produce 2-chloroethanol. The two products have been shown to have anti-inflammatory properties and can be used as topical treatments for inflammatory diseases such as psoriasis. This chemical is also used for reaction monitoring or as a quaternary ammonium compound. Reaction time and structural formula are shown below:
Formula:C4H8N6Purity:Min. 95%Color and Shape:PowderMolecular weight:140.15 g/mol2,4,5,6-Tetraaminopyrimidine
CAS:2,4,5,6-Tetraaminopyrimidine is a coloring agent.Formula:C4H8N6Purity:98%Color and Shape:SolidMolecular weight:140.15



