CAS 1004-84-8
:rel-(1R,2S)-1,2-Diethenylcyclohexane
Description:
Rel-(1R,2S)-1,2-Diethenylcyclohexane is an organic compound characterized by its unique bicyclic structure, which features a cyclohexane ring with two ethenyl (vinyl) groups attached at the 1 and 2 positions. This compound is a stereoisomer, specifically exhibiting a relative configuration that distinguishes it from its other isomers. The presence of the double bonds in the ethenyl groups contributes to its reactivity, making it a potential candidate for various chemical reactions, including polymerization and addition reactions. The compound is typically colorless and may have a distinct odor, characteristic of many hydrocarbons. Its physical properties, such as boiling point and melting point, are influenced by the molecular structure and the presence of the double bonds. Additionally, due to its unsaturated nature, it may participate in reactions typical of alkenes, such as electrophilic additions. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.
Formula:C10H16
InChI:InChI=1/C10H16/c1-3-9-7-5-6-8-10(9)4-2/h3-4,9-10H,1-2,5-8H2/t9-,10+
InChI key:InChIKey=ARKHCBWJALMQJO-AOOOYVTPNA-N
SMILES:C(=C)[C@H]1[C@@H](C=C)CCCC1
Synonyms:- cis-1,2-Divinylcyclohexane
- Cyclohexane, 1,2-diethenyl-, cis-
- Cyclohexane, 1,2-divinyl-, cis-
- Cyclohexane, 1,2-diethenyl-, (1R,2S)-rel-
- rel-(1R,2S)-1,2-Diethenylcyclohexane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
