CAS 10040-91-2
:5-[(3,4-Dimethoxyphenyl)methylene]-2,4-imidazolidinedione
Description:
5-[(3,4-Dimethoxyphenyl)methylene]-2,4-imidazolidinedione, identified by its CAS number 10040-91-2, is a chemical compound characterized by its imidazolidinedione core structure, which features a five-membered ring containing two nitrogen atoms and two carbonyl groups. This compound exhibits a methylene bridge connecting the imidazolidinedione to a 3,4-dimethoxyphenyl group, contributing to its unique properties. The presence of methoxy groups enhances its solubility and may influence its biological activity. Typically, compounds of this class can exhibit various pharmacological activities, including potential anti-inflammatory or antioxidant effects, although specific biological data for this compound may vary. Its molecular structure suggests it could participate in hydrogen bonding and other intermolecular interactions, which may affect its reactivity and stability. As with many organic compounds, proper handling and storage are essential to maintain its integrity and prevent degradation. Further research may be necessary to fully elucidate its properties and potential applications in medicinal chemistry or other fields.
Formula:C12H12N2O4
InChI:InChI=1S/C12H12N2O4/c1-17-9-4-3-7(6-10(9)18-2)5-8-11(15)14-12(16)13-8/h3-6H,1-2H3,(H2,13,14,15,16)
InChI key:InChIKey=NKQBXYVAZTZVMV-UHFFFAOYSA-N
SMILES:C(C1=CC(OC)=C(OC)C=C1)=C2C(=O)NC(=O)N2
Synonyms:- 2,4-Imidazolidinedione, 5-[(3,4-dimethoxyphenyl)methylene]-
- 2,4-Imidazolidinedione, 5-[(3,4-dimethoxyphenyl)methylene]-, (5Z)-
- 5-(3,4-Dimethoxybenzylidene)hydantoin
- 5-[(3,4-Dimethoxyphenyl)methylene]-2,4-imidazolidinedione
- Hydantoin, 5-veratrylidene-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
