CAS 100406-05-1
:Nitron
Description:
Nitron, with the CAS number 100406-05-1, is a chemical compound that is primarily recognized for its application in various industrial processes, particularly in the field of organic synthesis. It is characterized by its unique molecular structure, which includes functional groups that contribute to its reactivity and stability under specific conditions. Nitron is often utilized as an intermediate in the production of pharmaceuticals and agrochemicals, owing to its ability to participate in various chemical reactions, such as nucleophilic substitutions and cycloadditions. The compound typically exhibits moderate solubility in organic solvents, which facilitates its use in diverse chemical reactions. Additionally, safety data sheets indicate that it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, Nitron's chemical properties make it a valuable substance in synthetic chemistry, although specific handling and storage guidelines should be adhered to in order to ensure safe usage.
Formula:C20H16N4
InChI:InChI=1S/C20H16N4/c1-4-10-17(11-5-1)21-20-22-24(19-14-8-3-9-15-19)16-23(20)18-12-6-2-7-13-18/h1-16H
InChI key:InChIKey=CWGBFIRHYJNILV-UHFFFAOYSA-N
SMILES:[N-](C=1[N+](=CN(N1)C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4
Synonyms:- 1H-1,2,4-Triazolium, 1,4-diphenyl-3-(phenylamino)-, hydroxide, inner salt
- 4H-1,2,4-Triazolium, 1,4-diphenyl-3-(phenylamino)-, inner salt
- 1H-1,2,4-Triazolium, 1,4-diphenyl-3-(phenylamino)-, inner salt
- Nitron (analytical reagent)
- Nitron
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.