
CAS 100416-32-8
:Piperazine, 2-(4-methylcyclohexyl)-
Description:
Piperazine, 2-(4-methylcyclohexyl)- is an organic compound characterized by its piperazine core structure, which consists of a six-membered ring containing two nitrogen atoms at opposite positions. This particular derivative features a 4-methylcyclohexyl group attached to the second position of the piperazine ring, contributing to its unique properties. The compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with various biological targets. The presence of the cyclohexyl group may influence its lipophilicity and solubility, affecting its pharmacokinetic properties. Additionally, piperazine derivatives are often studied for their psychoactive effects and potential use in treating neurological disorders. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity and reactivity.
Formula:C11H22N2
InChI:InChI=1S/C11H22N2/c1-9-2-4-10(5-3-9)11-8-12-6-7-13-11/h9-13H,2-8H2,1H3
InChI key:InChIKey=BSTJHDVMXXIZEN-UHFFFAOYSA-N
SMILES:CC1CCC(CC1)C2CNCCN2
Synonyms:- Piperazine, 2-(4-methylcyclohexyl)-
- 2-(4-Methylcyclohexyl)piperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
