CAS 1004192-92-0

1-[(3,5-Dimethyl-1H-pyrazol-1-yl)methyl]-1H-pyrazole-3-carboxylic acid hydrazide

Description:

1-[(3,5-Dimethyl-1H-pyrazol-1-yl)methyl]-1H-pyrazole-3-carboxylic acid hydrazide is a chemical compound characterized by its complex structure, which includes multiple functional groups such as pyrazole rings and a hydrazide moiety. This compound typically exhibits properties associated with both pyrazole derivatives and hydrazides, including potential biological activity. Pyrazoles are known for their diverse pharmacological properties, which may include anti-inflammatory, analgesic, and antimicrobial effects. The presence of the carboxylic acid and hydrazide functional groups suggests that this compound may participate in various chemical reactions, including those involving amide formation or esterification. Additionally, the dimethyl substitution on the pyrazole ring can influence the compound's solubility and reactivity. Overall, this compound may be of interest in medicinal chemistry and drug development, although specific applications would depend on further research into its biological activity and pharmacokinetics. As with any chemical substance, safety and handling precautions should be observed, particularly in laboratory settings.

Formula: C₁₀H₁₄N₆O

InChI: InChI=1S/C10H14N6O/c1-7-5-8(2)16(13-7)6-15-4-3-9(14-15)10(17)12-11/h3-5H,6,11H2,1-2H3,(H,12,17)

InChI key: InChIKey=PPTUQKNITQUTLZ-UHFFFAOYSA-N

SMILES: C(N1N=C(C(NN)=O)C=C1)N2C(C)=CC(C)=N2

Synonyms:

• 1H-Pyrazole-3-carboxylic acid, 1-[(3,5-dimethyl-1H-pyrazol-1-yl)methyl]-, hydrazide
• 1-[(3,5-Dimethyl-1H-pyrazol-1-yl)methyl]-1H-pyrazole-3-carboxylic acid hydrazide