CAS 1004193-01-4
:1-[(2,3-Dichlorophenoxy)methyl]-1H-pyrazole-3-carboxylic acid
Description:
1-[(2,3-Dichlorophenoxy)methyl]-1H-pyrazole-3-carboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrazole ring and a carboxylic acid functional group. The presence of the 2,3-dichlorophenoxy moiety contributes to its potential biological activity, making it of interest in various fields, including agrochemicals and pharmaceuticals. This compound typically exhibits moderate to high solubility in organic solvents, while its solubility in water may vary depending on pH and temperature. Its molecular structure suggests potential interactions with biological targets, which could lead to herbicidal or fungicidal properties. Additionally, the presence of chlorine atoms in the aromatic ring may enhance its stability and lipophilicity, influencing its bioavailability and environmental persistence. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or environmental impact. Overall, this compound represents a class of chemicals that may have significant applications in crop protection and medicinal chemistry.
Formula:C11H8Cl2N2O3
InChI:InChI=1S/C11H8Cl2N2O3/c12-7-2-1-3-9(10(7)13)18-6-15-5-4-8(14-15)11(16)17/h1-5H,6H2,(H,16,17)
InChI key:InChIKey=FEUKMTTXQLBZAM-UHFFFAOYSA-N
SMILES:C(OC1=C(Cl)C(Cl)=CC=C1)N2N=C(C(O)=O)C=C2
Synonyms:- 1H-Pyrazole-3-carboxylic acid, 1-[(2,3-dichlorophenoxy)methyl]-
- 1-[(2,3-Dichlorophenoxy)methyl]-1H-pyrazole-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.