CAS 1004193-15-0

1-[[4-(1-Methylethyl)phenoxy]methyl]-1H-pyrazole-3-carboxylic acid

Description:

1-[[4-(1-Methylethyl)phenoxy]methyl]-1H-pyrazole-3-carboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrazole ring, a carboxylic acid functional group, and a phenoxy group substituted with an isopropyl group. This compound typically exhibits properties associated with both pyrazole derivatives and aromatic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylic acid moiety. It may also display biological activity, making it of interest in pharmaceutical research. The presence of the isopropyl group can influence its lipophilicity and overall molecular interactions. Additionally, the compound's specific stereochemistry and functional groups may contribute to its potential applications in agrochemicals or medicinal chemistry. As with many organic compounds, its stability, reactivity, and interactions with other substances can vary based on environmental conditions such as pH and temperature.

Formula: C₁₄H₁₆N₂O₃

InChI: InChI=1S/C14H16N2O3/c1-10(2)11-3-5-12(6-4-11)19-9-16-8-7-13(15-16)14(17)18/h3-8,10H,9H2,1-2H3,(H,17,18)

InChI key: InChIKey=NKJLHKVGKCHDOP-UHFFFAOYSA-N

SMILES: C(OC1=CC=C(C(C)C)C=C1)N2N=C(C(O)=O)C=C2

Synonyms:

• 1-[[4-(1-Methylethyl)phenoxy]methyl]-1H-pyrazole-3-carboxylic acid
• 1H-Pyrazole-3-carboxylic acid, 1-[[4-(1-methylethyl)phenoxy]methyl]-

1-{[4-(Propan-2-yl)phenoxy]methyl}-1H-pyrazole-3-carboxylic acid

CAS: 1004193-15-0

Versatile small molecule scaffold

Formula: C₁₄H₁₆N₂O₃

Purity: Min. 95%

Molecular weight: 260.29 g/mol

Ref: 3D-EQB19315