CAS 1004193-80-9

1-[(4-Bromophenoxy)methyl]-1H-pyrazole-3-carboxylic acid hydrazide

Description:

1-[(4-Bromophenoxy)methyl]-1H-pyrazole-3-carboxylic acid hydrazide is a chemical compound characterized by its unique structure, which includes a pyrazole ring, a carboxylic acid functional group, and a hydrazide moiety. The presence of the 4-bromophenoxy group enhances its potential for biological activity, making it of interest in medicinal chemistry. This compound typically exhibits moderate to high solubility in organic solvents, while its solubility in water may vary depending on pH and concentration. It may also display specific reactivity due to the hydrazide functional group, which can participate in various chemical reactions, including condensation and hydrazone formation. The compound's molecular structure suggests potential applications in pharmaceuticals, particularly in the development of anti-inflammatory or antimicrobial agents. Additionally, its bromine substituent may influence its electronic properties and reactivity, making it a candidate for further research in drug design and synthesis. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₁H₁₁BrN₄O₂

InChI: InChI=1S/C11H11BrN4O2/c12-8-1-3-9(4-2-8)18-7-16-6-5-10(15-16)11(17)14-13/h1-6H,7,13H2,(H,14,17)

InChI key: InChIKey=ICHVYBUJCVSRRI-UHFFFAOYSA-N

SMILES: C(OC1=CC=C(Br)C=C1)N2N=C(C(NN)=O)C=C2

Synonyms:

• 1-[(4-Bromophenoxy)methyl]-1H-pyrazole-3-carboxylic acid hydrazide
• 1H-Pyrazole-3-carboxylic acid, 1-[(4-bromophenoxy)methyl]-, hydrazide

1-(4-Bromo-phenoxymethyl)-1H-pyrazole-3-carboxylic acid hydrazide

CAS: 1004193-80-9

Versatile small molecule scaffold

Formula: C₁₁H₁₁BrN₄O₂

Purity: Min. 95%

Molecular weight: 311.13 g/mol

Ref: 3D-EQB19380