CymitQuimica logo

CAS 1004193-81-0

:

Methyl 1-[(2,4-difluorophenoxy)methyl]-1H-pyrazole-3-carboxylate

Description:
Methyl 1-[(2,4-difluorophenoxy)methyl]-1H-pyrazole-3-carboxylate is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a methyl ester functional group, contributing to its solubility and reactivity. The presence of a 2,4-difluorophenoxy group enhances its biological activity and may influence its interaction with various biological targets. The difluorophenyl moiety can impart unique electronic properties, potentially affecting the compound's pharmacokinetics and pharmacodynamics. As a pyrazole derivative, it may exhibit various biological activities, including potential applications in agrochemicals or pharmaceuticals. The compound's structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which are crucial for its efficacy in biological systems. Overall, Methyl 1-[(2,4-difluorophenoxy)methyl]-1H-pyrazole-3-carboxylate is a complex molecule with potential applications in medicinal chemistry and related fields, warranting further investigation into its properties and uses.
Formula:C12H10F2N2O3
InChI:InChI=1S/C12H10F2N2O3/c1-18-12(17)10-4-5-16(15-10)7-19-11-3-2-8(13)6-9(11)14/h2-6H,7H2,1H3
InChI key:InChIKey=FNOJUJGCZCLJEM-UHFFFAOYSA-N
SMILES:C(OC1=C(F)C=C(F)C=C1)N2N=C(C(OC)=O)C=C2
Synonyms:
  • Methyl 1-[(2,4-difluorophenoxy)methyl]-1H-pyrazole-3-carboxylate
  • 1H-Pyrazole-3-carboxylic acid, 1-[(2,4-difluorophenoxy)methyl]-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.