CymitQuimica logo

CAS 1004194-01-7

:

1-[(2-Chloro-5-methylphenoxy)methyl]-1H-pyrazole-3-carboxylic acid hydrazide

Description:
1-[(2-Chloro-5-methylphenoxy)methyl]-1H-pyrazole-3-carboxylic acid hydrazide is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a carboxylic acid group, and a hydrazide functional group. The presence of the 2-chloro-5-methylphenoxy moiety contributes to its potential biological activity, making it of interest in medicinal chemistry. This compound is typically synthesized through multi-step organic reactions, involving the introduction of the chloro and methyl groups onto the phenoxy ring and subsequent formation of the hydrazide linkage. It may exhibit various properties such as solubility in organic solvents, stability under specific conditions, and potential reactivity with other chemical species. The hydrazide functional group can participate in further chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, compounds of this nature may be evaluated for their pharmacological properties, including anti-inflammatory or antimicrobial activities, although specific biological data would depend on empirical studies.
Formula:C12H13ClN4O2
InChI:InChI=1S/C12H13ClN4O2/c1-8-2-3-9(13)11(6-8)19-7-17-5-4-10(16-17)12(18)15-14/h2-6H,7,14H2,1H3,(H,15,18)
InChI key:InChIKey=JNTSPXUWTNAIBW-UHFFFAOYSA-N
SMILES:C(OC1=C(Cl)C=CC(C)=C1)N2N=C(C(NN)=O)C=C2
Synonyms:
  • 1H-Pyrazole-3-carboxylic acid, 1-[(2-chloro-5-methylphenoxy)methyl]-, hydrazide
  • 1-[(2-Chloro-5-methylphenoxy)methyl]-1H-pyrazole-3-carboxylic acid hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.