CAS 1004194-03-9
:1-[(4-Chloro-3-methylphenoxy)methyl]-1H-pyrazole-3-carboxylic acid hydrazide
Description:
1-[(4-Chloro-3-methylphenoxy)methyl]-1H-pyrazole-3-carboxylic acid hydrazide is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a carboxylic acid functional group, and a hydrazide moiety. The presence of the 4-chloro-3-methylphenoxy group contributes to its potential biological activity, making it of interest in pharmaceutical research. This compound is likely to exhibit properties such as moderate solubility in organic solvents and varying solubility in water, influenced by the functional groups present. Its hydrazide functionality may impart reactivity towards electrophiles, making it a candidate for further chemical modifications. Additionally, the chlorinated aromatic component may enhance its lipophilicity, potentially affecting its bioavailability and interaction with biological targets. Overall, this compound's unique structural features suggest it may possess interesting pharmacological properties, warranting further investigation in medicinal chemistry and related fields.
Formula:C12H13ClN4O2
InChI:InChI=1S/C12H13ClN4O2/c1-8-6-9(2-3-10(8)13)19-7-17-5-4-11(16-17)12(18)15-14/h2-6H,7,14H2,1H3,(H,15,18)
InChI key:InChIKey=QTNMOACLCZSNLX-UHFFFAOYSA-N
SMILES:C(OC1=CC(C)=C(Cl)C=C1)N2N=C(C(NN)=O)C=C2
Synonyms:- 1-[(4-Chloro-3-methylphenoxy)methyl]-1H-pyrazole-3-carboxylic acid hydrazide
- 1H-Pyrazole-3-carboxylic acid, 1-[(4-chloro-3-methylphenoxy)methyl]-, hydrazide
- 1-[(4-chloro-3-methylphenoxy)methyl]-1H-pyrazole-3-carbohydrazide
Sort by
Found 0 products.