CymitQuimica logo

CAS 1004194-06-2

:

1-[(4-Chlorophenoxy)methyl]-1H-pyrazole-3-carboxylic acid hydrazide

Description:
1-[(4-Chlorophenoxy)methyl]-1H-pyrazole-3-carboxylic acid hydrazide is a chemical compound characterized by its unique structural features, which include a pyrazole ring, a carboxylic acid functional group, and a hydrazide moiety. The presence of the 4-chlorophenoxy group enhances its potential for biological activity, making it of interest in pharmaceutical research. This compound typically exhibits moderate solubility in polar solvents, which is influenced by the hydrophilic carboxylic acid and hydrazide functionalities. Its molecular structure suggests potential interactions with biological targets, possibly leading to applications in medicinal chemistry. The compound may also display specific reactivity due to the presence of the hydrazide group, which can participate in various chemical reactions, including condensation and acylation. Additionally, the chlorophenoxy substituent may impart unique electronic properties, affecting the compound's overall reactivity and stability. Overall, this compound represents a class of pyrazole derivatives that are being explored for their potential therapeutic applications.
Formula:C11H11ClN4O2
InChI:InChI=1S/C11H11ClN4O2/c12-8-1-3-9(4-2-8)18-7-16-6-5-10(15-16)11(17)14-13/h1-6H,7,13H2,(H,14,17)
InChI key:InChIKey=OTHGUGYECQXXDG-UHFFFAOYSA-N
SMILES:C(OC1=CC=C(Cl)C=C1)N2N=C(C(NN)=O)C=C2
Synonyms:
  • 1-[(4-Chlorophenoxy)methyl]-1H-pyrazole-3-carboxylic acid hydrazide
  • 1H-Pyrazole-3-carboxylic acid, 1-[(4-chlorophenoxy)methyl]-, hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.