CAS 1004194-14-2
:1-[(2,5-Dimethylphenoxy)methyl]-1H-pyrazole-3-carboxylic acid hydrazide
Description:
1-[(2,5-Dimethylphenoxy)methyl]-1H-pyrazole-3-carboxylic acid hydrazide is a chemical compound characterized by its unique structural features, which include a pyrazole ring and a hydrazide functional group. This compound typically exhibits properties associated with both hydrazides and pyrazoles, such as potential biological activity, including antimicrobial or anti-inflammatory effects. The presence of the 2,5-dimethylphenoxy group may enhance its lipophilicity, influencing its solubility and permeability in biological systems. The carboxylic acid moiety contributes to its acidity and potential reactivity, allowing for various chemical transformations. Additionally, the compound's molecular structure suggests it may participate in hydrogen bonding, which can affect its interactions with other molecules. Overall, this compound's characteristics make it of interest in medicinal chemistry and pharmaceutical research, although specific applications and biological activities would require further investigation and validation through experimental studies.
Formula:C13H16N4O2
InChI:InChI=1S/C13H16N4O2/c1-9-3-4-10(2)12(7-9)19-8-17-6-5-11(16-17)13(18)15-14/h3-7H,8,14H2,1-2H3,(H,15,18)
InChI key:InChIKey=JZPWAUFIAXUOOK-UHFFFAOYSA-N
SMILES:C(OC1=C(C)C=CC(C)=C1)N2N=C(C(NN)=O)C=C2
Synonyms:- 1-[(2,5-Dimethylphenoxy)methyl]-1H-pyrazole-3-carboxylic acid hydrazide
- 1H-Pyrazole-3-carboxylic acid, 1-[(2,5-dimethylphenoxy)methyl]-, hydrazide
- 1-[(2,5-dimethylphenoxy)methyl]-1H-pyrazole-3-carbohydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.