
CAS 1004194-68-6: Methyl 2-[(4-amino-1H-pyrazol-1-yl)methyl]benzoate
Description:Methyl 2-[(4-amino-1H-pyrazol-1-yl)methyl]benzoate is an organic compound characterized by its structure, which includes a benzoate moiety and a pyrazole ring. This compound features a methyl ester functional group, which contributes to its solubility in organic solvents. The presence of the amino group on the pyrazole ring suggests potential for hydrogen bonding and reactivity, making it of interest in medicinal chemistry and drug development. The compound may exhibit biological activity due to the pyrazole moiety, which is often associated with various pharmacological effects. Its molecular structure allows for potential interactions with biological targets, making it a candidate for further research in therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, Methyl 2-[(4-amino-1H-pyrazol-1-yl)methyl]benzoate represents a versatile chemical entity with potential applications in pharmaceuticals and biochemistry.
Formula:C12H13N3O2
InChI:InChI=1S/C12H13N3O2/c1-17-12(16)11-5-3-2-4-9(11)7-15-8-10(13)6-14-15/h2-6,8H,7,13H2,1H3
InChI key:InChIKey=QSFZLYUDTYBWMC-UHFFFAOYSA-N
SMILES:O=C(OC)C=1C=CC=CC1CN2N=CC(N)=C2
- Synonyms:
- Methyl 2-[(4-amino-1H-pyrazol-1-yl)methyl]benzoate
- Benzoic acid, 2-[(4-amino-1H-pyrazol-1-yl)methyl]-, methyl ester
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Methyl 2-((4-amino-1h-pyrazol-1-yl)methyl)benzoate REF: 10-F713416CAS: 1004194-68-6 | 97% | - - - | Discontinued product |
![]() | Methyl 2-(methyl)benzoate REF: 3D-EQB19468CAS: 1004194-68-6 | Min. 95% | - - - | Discontinued product |

Methyl 2-((4-amino-1h-pyrazol-1-yl)methyl)benzoate
Ref: 10-F713416
1g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |

Methyl 2-(methyl)benzoate
Ref: 3D-EQB19468
5mg | Discontinued | Request information | |
50mg | Discontinued | Request information |