CAS 1004194-71-1

4-Amino-1-ethyl-N-(2-methylpropyl)-1H-pyrazole-3-carboxamide

Description:

4-Amino-1-ethyl-N-(2-methylpropyl)-1H-pyrazole-3-carboxamide is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features an amino group and a carboxamide functional group, contributing to its potential as a bioactive molecule. The presence of an ethyl group and a branched 2-methylpropyl substituent enhances its lipophilicity, which may influence its solubility and permeability in biological systems. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its unique combination of functional groups may also impart specific reactivity and interaction profiles with biological targets. As with many organic compounds, the stability, reactivity, and biological activity of 4-Amino-1-ethyl-N-(2-methylpropyl)-1H-pyrazole-3-carboxamide can be influenced by environmental factors such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including drug development and agrochemicals.

Formula: C₁₀H₁₈N₄O

InChI: InChI=1S/C10H18N4O/c1-4-14-6-8(11)9(13-14)10(15)12-5-7(2)3/h6-7H,4-5,11H2,1-3H3,(H,12,15)

InChI key: InChIKey=DSDKMFPCDLUIKK-UHFFFAOYSA-N

SMILES: C(NCC(C)C)(=O)C1=NN(CC)C=C1N

Synonyms:

• 1H-Pyrazole-3-carboxamide, 4-amino-1-ethyl-N-(2-methylpropyl)-
• 4-Amino-1-ethyl-N-(2-methylpropyl)-1H-pyrazole-3-carboxamide