CAS 1004294-65-8

1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarbonyl chloride

Description:

1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a cyclopropanecarbonyl chloride moiety attached to a benzodioxole ring that is substituted with two fluorine atoms. This compound is likely to exhibit properties typical of acyl chlorides, such as high reactivity due to the presence of the carbonyl and chloride functional groups, making it a useful intermediate in organic synthesis. The difluorinated benzodioxole component may impart specific electronic and steric effects, influencing its reactivity and interactions with other molecules. Additionally, the presence of fluorine atoms can enhance lipophilicity and stability against hydrolysis compared to non-fluorinated analogs. The compound may be utilized in the development of pharmaceuticals or agrochemicals, where its reactivity can facilitate the formation of more complex structures. Safety considerations should be taken into account due to the potential hazards associated with handling acyl chlorides, including corrosiveness and the release of hydrochloric acid upon reaction with water.

Formula: C₁₁H₇ClF₂O₃

InChI: InChI=1S/C11H7ClF2O3/c12-9(15)10(3-4-10)6-1-2-7-8(5-6)17-11(13,14)16-7/h1-2,5H,3-4H2

InChI key: InChIKey=FVNYSBKXILOVTD-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C1(CC1)C=2C=C3C(=CC2)OC(F)(F)O3

Synonyms:

• Cyclopropanecarbonyl chloride, 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-
• 1-(2,2-Difluorobenzo[d][1,3]dioxol-5-yl)cyclopropanecarbonyl chloride
• 1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarbonyl chloride

Cyclopropanecarbonyl chloride, 1-(2,2-difluoro-1,3-benzodioxol-5-yl)-

CAS: 1004294-65-8

Formula: C₁₁H₇ClF₂O₃

Molecular weight: 260.6213

Ref: IN-DA0001YM