
CAS 1004316-93-1
:N-Methyl-N-[[2-(1-methylethyl)-4-thiazolyl]methyl]-N′-[(3S)-tetrahydro-2-oxo-3-furanyl]urea
Description:
N-Methyl-N-[[2-(1-methylethyl)-4-thiazolyl]methyl]-N′-[(3S)-tetrahydro-2-oxo-3-furanyl]urea, identified by its CAS number 1004316-93-1, is a synthetic organic compound characterized by its complex molecular structure, which includes a thiazole ring and a furan derivative. This compound features a urea functional group, which is known for its role in various biological activities and potential pharmacological applications. The presence of the thiazole moiety suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The compound is likely to exhibit moderate solubility in polar solvents due to its functional groups, and its stability may be influenced by environmental factors such as pH and temperature. Additionally, the stereochemistry indicated by the (3S) configuration suggests specific spatial arrangements that could affect its biological activity and interactions. Overall, this compound's unique structure positions it as a candidate for further research in drug development and related fields.
Formula:C13H19N3O3S
InChI:InChI=1S/C13H19N3O3S/c1-8(2)11-14-9(7-20-11)6-16(3)13(18)15-10-4-5-19-12(10)17/h7-8,10H,4-6H2,1-3H3,(H,15,18)/t10-/m0/s1
InChI key:InChIKey=CCSVVYNNTWRTHI-JTQLQIEISA-N
SMILES:C(N(C(N[C@@H]1C(=O)OCC1)=O)C)C=2N=C(C(C)C)SC2
Synonyms:- N-Methyl-N-[[2-(1-methylethyl)-4-thiazolyl]methyl]-N′-[(3S)-tetrahydro-2-oxo-3-furanyl]urea
- Urea, N-methyl-N-[[2-(1-methylethyl)-4-thiazolyl]methyl]-N′-[(3S)-tetrahydro-2-oxo-3-furanyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
