CAS 100440-26-4

Ganoderic acid J

Description:

Ganoderic acid J is a triterpenoid compound primarily derived from the medicinal mushroom Ganoderma lucidum, commonly known as reishi or lingzhi. This compound is characterized by its complex molecular structure, which includes multiple rings and functional groups typical of triterpenes. Ganoderic acid J exhibits various biological activities, including anti-inflammatory, antioxidant, and potential anticancer properties, making it of interest in pharmacological research. Its mechanism of action may involve modulation of cellular signaling pathways and inhibition of specific enzymes. Additionally, Ganoderic acid J is known for its ability to enhance immune function, contributing to the traditional use of Ganoderma lucidum in herbal medicine. The compound is typically studied in the context of natural product chemistry and pharmacognosy, where its extraction, purification, and bioactivity are key areas of investigation. Overall, Ganoderic acid J represents a significant component of the bioactive profile of Ganoderma lucidum, highlighting the importance of natural products in therapeutic applications.

Formula: C₃₀H₄₂O₇

InChI: InChI=1S/C30H42O7/c1-15(10-17(31)11-16(2)26(36)37)18-12-23(35)30(7)25-19(32)13-21-27(3,4)22(34)8-9-28(21,5)24(25)20(33)14-29(18,30)6/h15-16,18,21,23,35H,8-14H2,1-7H3,(H,36,37)

InChI key: InChIKey=KIJCKCLHIXLFEW-UHFFFAOYSA-N

SMILES: CC12C3=C(C4(C)C(CC3=O)C(C)(C)C(=O)CC4)C(=O)CC1(C)C(C(CC(CC(C(O)=O)C)=O)C)CC2O

Synonyms:

• Ganoderic acid J
• Ganodericacid J
• Lanost-8-en-26-oic acid, 15-hydroxy-3,7,11,23-tetraoxo-, (15α)-
• (15α)-15-Hydroxy-3,7,11,23-tetraoxolanost-8-en-26-oic acid

Ganoderic acid J

CAS: 100440-26-4

Ganoderic acid J

Purity: 98%

Ref: 54-OR1037217

Ganoderic acid J

CAS: 100440-26-4

Formula: C₃₀H₄₂O₇

Molecular weight: 514.659

Ref: 7W-GY0779

Ganoderic acid J

CAS: 100440-26-4

Ganoderic acid J, a natural terpenoid extracted from Ganoderma lucidum fungus, exhibits anti-inflammatory properties.

Formula: C₃₀H₄₂O₇

Color and Shape: Solid

Molecular weight: 514.659

Ref: TM-T38396

Ganoderic acid J

CAS: 100440-26-4

Formula: C₃₀H₄₂O₇

Purity: 95%~99%

Molecular weight: 514.659

Ref: BP-BP2171

Ganoderic acid J

CAS: 100440-26-4

Ganoderic acid J is a triterpenoid, which is a type of bioactive compound derived from the fungus Ganoderma lucidum, commonly known as the Reishi mushroom. This compound is part of a diverse group of secondary metabolites that have been isolated from Ganoderma species. The mode of action for ganoderic acid J involves modulation of various signaling pathways, including anti-inflammatory and antioxidative pathways, highlighting its potential to alter cellular processes and immune responses.

Formula: C₃₀H₄₂O₇

Purity: Min. 95%

Molecular weight: 514.6 g/mol

Ref: 3D-AEA44026