CAS 1004451-74-4

1′,5′-Dimethyl-1-phenyl[3,4′-bi-1H-pyrazole]-4-carboxaldehyde

Description:

1′,5′-Dimethyl-1-phenyl[3,4′-bi-1H-pyrazole]-4-carboxaldehyde is a chemical compound characterized by its complex structure, which includes a bi-pyrazole framework and an aldehyde functional group. This compound features two methyl groups attached to the pyrazole ring, enhancing its lipophilicity and potentially influencing its biological activity. The presence of the phenyl group contributes to its aromatic character, which can affect its reactivity and interaction with other molecules. The aldehyde functional group is known for its reactivity, particularly in condensation reactions and as a precursor in various synthetic pathways. This compound may exhibit interesting properties such as fluorescence or biological activity, making it of interest in fields like medicinal chemistry and materials science. Its specific applications and behavior would depend on further studies, including its solubility, stability, and interaction with biological systems. Overall, 1′,5′-Dimethyl-1-phenyl[3,4′-bi-1H-pyrazole]-4-carboxaldehyde represents a unique structure with potential utility in various chemical and pharmaceutical applications.

Formula: C₁₅H₁₄N₄O

InChI: InChI=1S/C15H14N4O/c1-11-14(8-16-18(11)2)15-12(10-20)9-19(17-15)13-6-4-3-5-7-13/h3-10H,1-2H3

InChI key: InChIKey=VVQRSHACUHYRRI-UHFFFAOYSA-N

SMILES: C(=O)C=1C(=NN(C1)C2=CC=CC=C2)C3=C(C)N(C)N=C3

Synonyms:

• [3,4′-Bi-1H-pyrazole]-4-carboxaldehyde, 1′,5′-dimethyl-1-phenyl-
• 1′,5′-Dimethyl-1-phenyl[3,4′-bi-1H-pyrazole]-4-carboxaldehyde
• 1,5-dimethyl-1-phenyl-1H,1H-3,4-bipyrazole-4-carbaldehyde
• [3,4'-Bi-1H-pyrazole]-4-carboxaldehyde, 1',5'-dimethyl-1-phenyl-

1',5'-Dimethyl-1-phenyl-1H,1'H-[3,4']bipyrazolyl-4-carbaldehyde

CAS: 1004451-74-4

Versatile small molecule scaffold

Formula: C₁₅H₁₄N₄O

Purity: Min. 95%

Molecular weight: 266.3 g/mol

Ref: 3D-EQB45174