CAS 1004451-75-5

1′-Ethyl-1-phenyl[3,4′-bi-1H-pyrazole]-4-carboxaldehyde

Description:

1′-Ethyl-1-phenyl[3,4′-bi-1H-pyrazole]-4-carboxaldehyde is a chemical compound characterized by its unique structure, which includes a bi-pyrazole framework and an aldehyde functional group. This compound typically exhibits properties associated with both pyrazole derivatives and aldehydes, such as potential reactivity in condensation reactions and the ability to participate in nucleophilic attacks due to the electrophilic nature of the carbonyl carbon in the aldehyde group. The presence of the ethyl and phenyl substituents contributes to its hydrophobic characteristics, influencing its solubility in organic solvents. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific reactivity and interactions can vary based on the surrounding environment and the presence of other functional groups. Overall, 1′-Ethyl-1-phenyl[3,4′-bi-1H-pyrazole]-4-carboxaldehyde represents a versatile structure with potential applications in various chemical and pharmaceutical contexts.

Formula: C₁₅H₁₄N₄O

InChI: InChI=1S/C15H14N4O/c1-2-18-9-12(8-16-18)15-13(11-20)10-19(17-15)14-6-4-3-5-7-14/h3-11H,2H2,1H3

InChI key: InChIKey=CIEPCSFZFUSNIW-UHFFFAOYSA-N

SMILES: C(=O)C=1C(=NN(C1)C2=CC=CC=C2)C3=CN(CC)N=C3