
CAS 1004451-77-7
:4-Chloro-1-[(1-ethyl-3-methyl-1H-pyrazol-4-yl)methyl]-1H-pyrazol-3-amine
Description:
4-Chloro-1-[(1-ethyl-3-methyl-1H-pyrazol-4-yl)methyl]-1H-pyrazol-3-amine is a chemical compound characterized by its complex structure, which includes multiple pyrazole rings and a chloro substituent. This compound features a chloro group at the 4-position of one pyrazole ring and an ethyl and methyl substituent on another pyrazole ring, contributing to its unique reactivity and potential biological activity. It is typically classified as an organic compound and may exhibit properties such as solubility in organic solvents, moderate stability under standard conditions, and potential interactions with biological targets due to its amine functional group. The presence of the pyrazole moiety suggests possible applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical determination or reference to scientific literature for precise values. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.
Formula:C10H14ClN5
InChI:InChI=1S/C10H14ClN5/c1-3-15-4-8(7(2)13-15)5-16-6-9(11)10(12)14-16/h4,6H,3,5H2,1-2H3,(H2,12,14)
InChI key:InChIKey=HKQVQIFWRFLJGC-UHFFFAOYSA-N
SMILES:C(C1=CN(CC)N=C1C)N2C=C(Cl)C(N)=N2
Synonyms:- 1H-Pyrazol-3-amine, 4-chloro-1-[(1-ethyl-3-methyl-1H-pyrazol-4-yl)methyl]-
- 4-Chloro-1-[(1-ethyl-3-methyl-1H-pyrazol-4-yl)methyl]-1H-pyrazol-3-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.