CAS 1004452-02-1
:4-Chloro-1-[(1-ethyl-1H-pyrazol-4-yl)methyl]-1H-pyrazol-3-amine
Description:
4-Chloro-1-[(1-ethyl-1H-pyrazol-4-yl)methyl]-1H-pyrazol-3-amine is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a chloro substituent at the 4-position and an ethyl group attached to a pyrazole moiety at the 1-position contributes to its unique reactivity and potential biological activity. This compound is likely to exhibit properties typical of pyrazole derivatives, such as potential anti-inflammatory, analgesic, or antimicrobial activities, depending on its specific interactions with biological targets. The amine functional group at the 3-position enhances its ability to participate in hydrogen bonding, which can influence its solubility and reactivity. Additionally, the compound's structure suggests it may be of interest in medicinal chemistry and drug development, particularly in the search for new therapeutic agents. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature.
Formula:C9H12ClN5
InChI:InChI=1S/C9H12ClN5/c1-2-14-4-7(3-12-14)5-15-6-8(10)9(11)13-15/h3-4,6H,2,5H2,1H3,(H2,11,13)
InChI key:InChIKey=RJXOPOLBWWRJPZ-UHFFFAOYSA-N
SMILES:C(C1=CN(CC)N=C1)N2C=C(Cl)C(N)=N2
Synonyms:- 1H-Pyrazol-3-amine, 4-chloro-1-[(1-ethyl-1H-pyrazol-4-yl)methyl]-
- 4-Chloro-1-[(1-ethyl-1H-pyrazol-4-yl)methyl]-1H-pyrazol-3-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.