CAS 1004452-03-2: 4-Chloro-1-[(1-methyl-1H-pyrazol-4-yl)methyl]-1H-pyrazol-3-amine

Description: 4-Chloro-1-[(1-methyl-1H-pyrazol-4-yl)methyl]-1H-pyrazol-3-amine, identified by its CAS number 1004452-03-2, is a chemical compound characterized by its pyrazole core structure, which features both chloro and amino functional groups. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the pyrazole moiety, which is known for its role in various pharmacological applications. The chloro substituent can influence the compound's reactivity and solubility, while the methyl group on the pyrazole ring may affect its steric and electronic properties. Such compounds are often investigated for their potential as pharmaceuticals, agrochemicals, or in materials science. The specific interactions and stability of this compound can vary based on environmental conditions, such as pH and temperature, and it may undergo various chemical reactions typical of amines and halogenated compounds. Overall, this substance represents a class of compounds with significant interest in medicinal chemistry and related fields.

Formula: C₈H₁₀ClN₅

InChI: InChI=1S/C8H10ClN5/c1-13-3-6(2-11-13)4-14-5-7(9)8(10)12-14/h2-3,5H,4H2,1H3,(H2,10,12)

InChI key: InChIKey=URIVTZZNPMZCEX-UHFFFAOYSA-N

SMILES: ClC1=CN(N=C1N)CC=2C=NN(C2)C

Synonyms:

• 4-Chloro-1-[(1-methyl-1H-pyrazol-4-yl)methyl]-1H-pyrazol-3-amine
• 1H-Pyrazol-3-amine, 4-chloro-1-[(1-methyl-1H-pyrazol-4-yl)methyl]-

4-Chloro-1-[(1-methyl-1H-pyrazol-4-yl)methyl]-1H-pyrazol-3-amine

CAS: 1004452-03-2

Versatile small molecule scaffold

• Formula: C₈H₁₀ClN₅
• Purity: Min. 95%
• Molecular weight: 211.65 g/mol

4-Chloro-1-(1-methyl-1 H -pyrazol-4-ylmethyl)-1 H-pyrazol-3-ylamine

CAS: 1004452-03-2

• Molecular weight: 211.64999389648438