CAS 100446-36-4

2-[(1E)-2-Nitroethenyl]pyridine

Description:

2-[(1E)-2-Nitroethenyl]pyridine, with the CAS number 100446-36-4, is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a nitroethenyl substituent at the 2-position of the pyridine, indicating the presence of a nitro group (-NO2) attached to a vinyl group (C=C) that is conjugated with the aromatic system. The presence of the nitro group typically imparts significant polarity and can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions. The compound may exhibit properties such as solubility in polar solvents and potential biological activity, which can be explored in medicinal chemistry. Its structural features suggest that it could participate in various synthetic pathways, making it of interest in organic synthesis and materials science. As with many nitro compounds, it may also be subject to specific safety and handling considerations due to its potential reactivity and toxicity.

Formula: C₇H₆N₂O₂

InChI: InChI=1S/C7H6N2O2/c10-9(11)6-4-7-3-1-2-5-8-7/h1-6H/b6-4+

InChI key: InChIKey=NENONAVUOMQKMC-GQCTYLIASA-N

SMILES: C(=C/N(=O)=O)\C1=CC=CC=N1

Synonyms:

• 2-[(1E)-2-Nitroethenyl]pyridine
• Pyridine, 2-[(1E)-2-nitroethenyl]-
• (E)-2-(2-Nitrovinyl)pyridine
• Pyridine, 2-(2-nitroethenyl)-, (E)-