CAS 10045-45-1: 1-EBIO
Description:1-EBIO, or 1-ethyl-2-benzimidazolinone, is a chemical compound characterized by its unique structure that includes a benzimidazole ring. It is primarily recognized for its role as a fluorescent probe and is often utilized in biochemical and analytical applications. The compound exhibits solubility in organic solvents, making it suitable for various laboratory settings. 1-EBIO is known to interact with biological systems, particularly in the context of cellular signaling and ion channel modulation. Its fluorescence properties allow for the detection and quantification of specific biological molecules, contributing to its utility in research. Additionally, 1-EBIO may exhibit specific reactivity patterns, which can be leveraged in synthetic chemistry. Safety data indicates that, like many chemical substances, it should be handled with care, following appropriate safety protocols to mitigate any potential hazards. Overall, 1-EBIO is a versatile compound with significant applications in both research and industry.
Formula:C9H10N2O
InChI:InChI=1S/C9H10N2O/c1-2-11-8-6-4-3-5-7(8)10-9(11)12/h3-6H,2H2,1H3,(H,10,12)
InChI key:InChIKey=CXUCKELNYMZTRT-UHFFFAOYSA-N
SMILES:O=C1NC=2C=CC=CC2N1CC
- Synonyms:
- 1-Ebio
- 1-Ethyl-1,3-dihydrobenzimidazol-2-one
- 1-Ethyl-2,3-dihydro-1H-1,3-benzodiazol-2-one
- 1-Ethyl-2-benzimidazolinone
- 1-Ethyl-2-oxo-2,3-dihydrobenzimidazole
- 1-Ethylbenzimidazolinone
- 1-ethyl-1,3-dihydro-2H-benzimidazol-2-one
- 2-Benzimidazolinone, 1-ethyl-
- 2H-Benzimidazol-2-one, 1-ethyl-1,3-dihydro-
- 3-Ethyl-1H-benzimidazol-2-one
- See more synonyms
- 3-Ethyl-2-benzimidazolinone
- 1-Ethylbenzimidazolin-2-one
