CAS 10045-66-6

4,5-Diiodo-2-phenyl-1H-imidazole

Description:

4,5-Diiodo-2-phenyl-1H-imidazole is a chemical compound characterized by its imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of two iodine atoms at the 4 and 5 positions of the imidazole ring significantly influences its chemical properties, including its reactivity and potential applications in medicinal chemistry. The phenyl group at the 2 position contributes to the compound's hydrophobic character and can enhance its biological activity. This compound is often studied for its potential use in pharmaceuticals, particularly in the development of antimicrobial and antifungal agents. Its iodine substituents may also impart unique electronic properties, making it a subject of interest in various chemical reactions and synthesis processes. Additionally, the compound's stability and solubility in organic solvents can vary, affecting its handling and application in laboratory settings. Overall, 4,5-Diiodo-2-phenyl-1H-imidazole represents a versatile structure in organic chemistry with potential implications in drug discovery and development.

Formula: C₉H₆I₂N₂

InChI: InChI=1S/C9H6I2N2/c10-7-8(11)13-9(12-7)6-4-2-1-3-5-6/h1-5H,(H,12,13)

InChI key: InChIKey=NJEAORDUNICUGM-UHFFFAOYSA-N

SMILES: IC=1NC(=NC1I)C2=CC=CC=C2

Synonyms:

• NSC 9010
• Imidazole, 4,5-diiodo-2-phenyl-
• 4,5-Diiodo-2-phenylimidazole
• 4,5-Diiodo-2-phenyl-1H-imidazole
• 1H-Imidazole, 4,5-diiodo-2-phenyl-

1H-Imidazole, 4,5-diiodo-2-phenyl-

CAS: 10045-66-6

Formula: C₉H₆I₂N₂

Molecular weight: 395.9663

Ref: IN-DA000210