CAS 1004527-75-6

Piperidine, 4-(5-phenyl-1,3,4-oxadiazol-2-yl)-, hydrochloride (1:1)

Description:

Piperidine, 4-(5-phenyl-1,3,4-oxadiazol-2-yl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The compound features a phenyl-substituted 1,3,4-oxadiazole moiety, which contributes to its potential biological activity and pharmacological properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in medicinal chemistry. The presence of the oxadiazole group may impart unique electronic and steric properties, making it of interest in drug design and development. The compound is likely to exhibit specific interactions with biological targets, which can be explored for therapeutic purposes. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies would be necessary to elucidate its full range of properties, including its stability, reactivity, and potential applications in various fields.

Formula: C₁₃H₁₅N₃O·ClH

InChI: InChI=1S/C13H15N3O.ClH/c1-2-4-10(5-3-1)12-15-16-13(17-12)11-6-8-14-9-7-11;/h1-5,11,14H,6-9H2;1H

InChI key: InChIKey=QGZRSHKENQEFIN-UHFFFAOYSA-N

SMILES: C=1(OC(=NN1)C2CCNCC2)C3=CC=CC=C3.Cl

Synonyms:

• Piperidine, 4-(5-phenyl-1,3,4-oxadiazol-2-yl)-, hydrochloride (1:1)
• 2-Phenyl-5-(piperidin-4-yl)-1,3,4-oxadiazole hydrochloride

Piperidine, 4-(5-phenyl-1,3,4-oxadiazol-2-yl)-, hydrochloride (1:1)

CAS: 1004527-75-6

Formula: C₁₃H₁₆ClN₃O

Purity: 98%

Molecular weight: 265.7386

Ref: IN-DA00020N

2-Phenyl-5-(piperidin-4-yl)-1,3,4-oxadiazole hydrochloride

CAS: 1004527-75-6

2-Phenyl-5-(piperidin-4-yl)-1,3,4-oxadiazole hydrochloride

Purity: 98%

Ref: 54-OR1077016