CAS 1004538-30-0: 1-Pyrrolidinecarboxylic acid, 3-(methylamino)-, 1,1-dimethylethyl ester, hydrochloride (1:1), (3S)-
Description:1-Pyrrolidinecarboxylic acid, 3-(methylamino)-, 1,1-dimethylethyl ester, hydrochloride (1:1), (3S)-, is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered nitrogen-containing ring. This compound features a carboxylic acid functional group and an ester linkage, indicating it is an ester derivative. The presence of a methylamino group suggests it has basic properties, which can influence its solubility and reactivity. The hydrochloride form indicates that the compound is a salt, typically enhancing its stability and solubility in aqueous solutions. The (3S)- designation refers to its specific stereochemistry, which can affect its biological activity and interactions. This compound may be of interest in pharmaceutical applications due to its structural features, which could relate to various biological activities. As with many chemical substances, safety and handling precautions should be observed, particularly due to potential toxicity or reactivity associated with amine and acid functionalities.
Formula:C10H20N2O2·ClH
InChI:InChI=1S/C10H20N2O2.ClH/c1-10(2,3)14-9(13)12-6-5-8(7-12)11-4;/h8,11H,5-7H2,1-4H3;1H/t8-;/m0./s1
InChI key:InChIKey=WWPYESMMWKHVRS-QRPNPIFTSA-N
SMILES:Cl.O=C(OC(C)(C)C)N1CCC(NC)C1
- Synonyms:
- 1-Pyrrolidinecarboxylic acid, 3-(methylamino)-, 1,1-dimethylethyl ester, hydrochloride (1:1), (3S)-
- (S)-tert-Butyl 3-(methylamino)pyrrolidine-1-carboxylate hydrochloride
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 1-Pyrrolidinecarboxylic acid, 3-(methylamino)-, 1,1-dimethylethyl ester, hydrochloride (1:1), (3S)- REF: IN-DA00020LCAS: 1004538-30-0 | - - - | To inquire | Mon 07 Apr 25 |
 | tert-Butyl (3S)-3-(methylamino)pyrrolidine-1-carboxylate hydrochloride REF: 10-F624711CAS: 1004538-30-0 | 98+% | - - - | Discontinued product |
 | (S)-tert-Butyl 3-(methylamino)pyrrolidine-1-carboxylate hydrochloride REF: 3D-EQB53830CAS: 1004538-30-0 | Min. 95% | - - - | Discontinued product |
1-Pyrrolidinecarboxylic acid, 3-(methylamino)-, 1,1-dimethylethyl ester, hydrochloride (1:1), (3S)-
Ref: IN-DA00020L
| Undefined size | To inquire |
tert-Butyl (3S)-3-(methylamino)pyrrolidine-1-carboxylate hydrochloride
Ref: 10-F624711
| 1g | Discontinued | Request information |
(S)-tert-Butyl 3-(methylamino)pyrrolidine-1-carboxylate hydrochloride
Ref: 3D-EQB53830
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
