
CAS 1004619-99-1
:4-(Propylsulfonyl)piperidine
Description:
4-(Propylsulfonyl)piperidine is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a propylsulfonyl group at the 4-position of the piperidine ring contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. It is soluble in organic solvents, which is common for sulfonyl derivatives. The sulfonyl group enhances the compound's reactivity, making it useful in various chemical syntheses and applications, particularly in medicinal chemistry and drug development. The compound may exhibit biological activity, potentially influencing its pharmacological properties. As with many sulfonyl-containing compounds, it may participate in nucleophilic substitution reactions and can serve as a building block for more complex molecules. Safety data should be consulted for handling and storage, as sulfonyl compounds can vary in toxicity and reactivity.
Formula:C8H17NO2S
InChI:InChI=1S/C8H17NO2S/c1-2-7-12(10,11)8-3-5-9-6-4-8/h8-9H,2-7H2,1H3
InChI key:InChIKey=DKTSBKXVRSABTM-UHFFFAOYSA-N
SMILES:S(CCC)(=O)(=O)C1CCNCC1
Synonyms:- Piperidine, 4-(propylsulfonyl)-
- 4-(Propylsulfonyl)piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.