CymitQuimica logo

CAS 1004620-23-8

:

2-(1,1-Dimethylethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-7-carboxylic acid

Description:
2-(1,1-Dimethylethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-7-carboxylic acid is a chemical compound characterized by its complex bicyclic structure, which includes an imidazole and a pyridine ring. This compound features a tert-butyl group (1,1-dimethylethyl) that contributes to its hydrophobic properties, potentially influencing its solubility and interaction with biological systems. The presence of a carboxylic acid functional group indicates that it can participate in acid-base reactions, making it a potential candidate for various chemical syntheses and biological applications. Its tetrahydro configuration suggests that it is a saturated derivative, which may affect its reactivity and stability. The compound's unique structure may also impart specific pharmacological properties, making it of interest in medicinal chemistry. Overall, its characteristics, including molecular weight, solubility, and reactivity, would be essential for understanding its potential applications in research and industry.
Formula:C12H18N2O2
InChI:InChI=1S/C12H18N2O2/c1-12(2,3)9-7-14-5-4-8(11(15)16)6-10(14)13-9/h7-8H,4-6H2,1-3H3,(H,15,16)
InChI key:InChIKey=VJKJECOUSYWXAU-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C=1N=C2N(C1)CCC(C(O)=O)C2
Synonyms:
  • Imidazo[1,2-a]pyridine-7-carboxylic acid, 2-(1,1-dimethylethyl)-5,6,7,8-tetrahydro-
  • 2-(1,1-Dimethylethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-7-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.