CAS 1004620-24-9

5,6,7,8-Tetrahydro-2-phenylimidazo[1,2-a]pyridine-7-carboxylic acid

Description:

5,6,7,8-Tetrahydro-2-phenylimidazo[1,2-a]pyridine-7-carboxylic acid is a heterocyclic compound characterized by its imidazo[1,2-a]pyridine core, which features a fused bicyclic structure containing nitrogen atoms. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry. Its structure includes a phenyl group, contributing to its lipophilicity and potential interactions with biological targets. The presence of a carboxylic acid functional group suggests it may participate in hydrogen bonding and ionic interactions, enhancing its solubility in polar solvents. The tetrahydro configuration indicates that the compound is saturated in certain positions, which can influence its reactivity and stability. Overall, this compound's unique structural features and functional groups may contribute to its pharmacological properties, making it a candidate for further research in drug development and therapeutic applications.

Formula: C₁₄H₁₄N₂O₂

InChI: InChI=1S/C14H14N2O2/c17-14(18)11-6-7-16-9-12(15-13(16)8-11)10-4-2-1-3-5-10/h1-5,9,11H,6-8H2,(H,17,18)

InChI key: InChIKey=WLXSJSDOQVYTFB-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CC=2N(C=C(N2)C3=CC=CC=C3)CC1

Synonyms:

• Imidazo[1,2-a]pyridine-7-carboxylic acid, 5,6,7,8-tetrahydro-2-phenyl-
• 5,6,7,8-Tetrahydro-2-phenylimidazo[1,2-a]pyridine-7-carboxylic acid