CAS 1004643-33-7
:1-[(2,2,2-Trifluoroethoxy)methyl]-1H-pyrazol-4-amine
Description:
1-[(2,2,2-Trifluoroethoxy)methyl]-1H-pyrazol-4-amine is a chemical compound characterized by its unique structural features, which include a pyrazole ring and a trifluoroethoxy group. The presence of the trifluoroethoxy moiety imparts significant hydrophobicity and influences the compound's reactivity and solubility in various solvents. This compound typically exhibits properties such as moderate to high stability under standard conditions, and it may participate in hydrogen bonding due to the amine functional group. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of bioactive compounds, as pyrazole derivatives are often explored for their biological activities. Additionally, the trifluoromethyl group can enhance the lipophilicity and metabolic stability of the compound, making it a candidate for further research in medicinal chemistry. Safety data and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C6H8F3N3O
InChI:InChI=1S/C6H8F3N3O/c7-6(8,9)3-13-4-12-2-5(10)1-11-12/h1-2H,3-4,10H2
InChI key:InChIKey=SNIXCDHCKPVOSY-UHFFFAOYSA-N
SMILES:C(OCC(F)(F)F)N1C=C(N)C=N1
Synonyms:- 1-[(2,2,2-Trifluoroethoxy)methyl]-1H-pyrazol-4-amine
- 1-(2,2,2-Trifluoro-ethoxymethyl)-1H-pyrazol-4-ylamine
- 1H-Pyrazol-4-amine, 1-[(2,2,2-trifluoroethoxy)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.