CAS 1004643-37-1
:3,5-Dimethyl-1-phenyl-1H-pyrazole-4-propanoic acid hydrazide
Description:
3,5-Dimethyl-1-phenyl-1H-pyrazole-4-propanoic acid hydrazide is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with methyl and phenyl groups, along with a hydrazide functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the hydrazide moiety, which can participate in various chemical reactions, including condensation and hydrazone formation. It may also display biological activity, making it of interest in pharmaceutical research. The presence of the pyrazole ring suggests potential applications in medicinal chemistry, particularly in the development of anti-inflammatory or analgesic agents. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 3,5-Dimethyl-1-phenyl-1H-pyrazole-4-propanoic acid hydrazide represents a versatile structure with potential applications in both synthetic and medicinal chemistry.
Formula:C14H18N4O
InChI:InChI=1S/C14H18N4O/c1-10-13(8-9-14(19)16-15)11(2)18(17-10)12-6-4-3-5-7-12/h3-7H,8-9,15H2,1-2H3,(H,16,19)
InChI key:InChIKey=BMXHVGXRPPQRSF-UHFFFAOYSA-N
SMILES:CC=1N(N=C(C)C1CCC(NN)=O)C2=CC=CC=C2
Synonyms:- 3,5-Dimethyl-1-phenyl-1H-pyrazole-4-propanoic acid hydrazide
- 1H-Pyrazole-4-propanoic acid, 3,5-dimethyl-1-phenyl-, hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.