CAS 1004643-38-2

Methyl 4-bromo-5-methyl-1H-pyrazole-1-propanoate

Description:

Methyl 4-bromo-5-methyl-1H-pyrazole-1-propanoate is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a bromine atom at the 4-position and a methyl group at the 5-position of the pyrazole ring, contributing to its unique reactivity and properties. The presence of the propanoate group indicates that it is an ester, which can influence its solubility and reactivity in various chemical environments. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure suggests potential applications in agrochemicals or as intermediates in organic synthesis. Additionally, the bromine substituent can enhance the compound's electrophilicity, making it useful in further chemical transformations. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₈H₁₁BrN₂O₂

InChI: InChI=1S/C8H11BrN2O2/c1-6-7(9)5-10-11(6)4-3-8(12)13-2/h5H,3-4H2,1-2H3

InChI key: InChIKey=WFYKZGVNGJOIDJ-UHFFFAOYSA-N

SMILES: C(CC(OC)=O)N1C(C)=C(Br)C=N1

Synonyms:

• 1H-Pyrazole-1-propanoic acid, 4-bromo-5-methyl-, methyl ester
• Methyl 4-bromo-5-methyl-1H-pyrazole-1-propanoate

Methyl 3-(4-bromo-5-methyl-1H-pyrazol-1-yl)propanoate

CAS: 1004643-38-2

Versatile small molecule scaffold

Formula: C₈H₁₁BrN₂O₂

Purity: Min. 95%

Molecular weight: 247.09 g/mol

Ref: 3D-EQB64338