CAS 1004643-42-8

4-[(3,5-Dimethyl-1H-pyrazol-1-yl)methyl]benzoic acid hydrazide

Description:

4-[(3,5-Dimethyl-1H-pyrazol-1-yl)methyl]benzoic acid hydrazide is a chemical compound characterized by its hydrazide functional group, which is derived from benzoic acid. This compound features a pyrazole ring, specifically 3,5-dimethyl-1H-pyrazole, that is linked to a benzoic acid moiety through a methylene bridge. The presence of the dimethyl groups on the pyrazole ring contributes to its hydrophobic characteristics, potentially influencing its solubility and reactivity. The hydrazide functional group can participate in various chemical reactions, including hydrazone formation and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may exhibit biological activity, making it of interest for further research in drug development. Its molecular structure suggests potential interactions with biological targets, which could be explored in pharmacological studies. As with many organic compounds, its stability, reactivity, and biological properties would depend on environmental conditions and the presence of other chemical species.

Formula: C₁₃H₁₆N₄O

InChI: InChI=1S/C13H16N4O/c1-9-7-10(2)17(16-9)8-11-3-5-12(6-4-11)13(18)15-14/h3-7H,8,14H2,1-2H3,(H,15,18)

InChI key: InChIKey=NKOZXSZCXDVHHR-UHFFFAOYSA-N

SMILES: C(N1C(C)=CC(C)=N1)C2=CC=C(C(NN)=O)C=C2

Synonyms:

• 4-[(3,5-Dimethyl-1H-pyrazol-1-yl)methyl]benzoic acid hydrazide
• Benzoic acid, 4-[(3,5-dimethyl-1H-pyrazol-1-yl)methyl]-, hydrazide