
CAS 1004643-43-9
:2-Chloro-N-[1-[(2-chloro-6-fluorophenyl)methyl]-1H-pyrazol-3-yl]acetamide
Description:
2-Chloro-N-[1-[(2-chloro-6-fluorophenyl)methyl]-1H-pyrazol-3-yl]acetamide is a chemical compound characterized by its complex structure, which includes a chloro-substituted phenyl group and a pyrazole moiety. This compound typically exhibits properties associated with both its aromatic and heterocyclic components, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups like the acetamide and chloro groups. It may display biological activity, making it of interest in pharmaceutical research, particularly in the development of therapeutic agents. The presence of fluorine and chlorine atoms can influence its lipophilicity and metabolic stability. Additionally, the compound's molecular structure suggests potential interactions with biological targets, which could be explored in medicinal chemistry. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact. Overall, this compound represents a class of molecules that may have significant implications in drug discovery and development.
Formula:C12H10Cl2FN3O
InChI:InChI=1S/C12H10Cl2FN3O/c13-6-12(19)16-11-4-5-18(17-11)7-8-9(14)2-1-3-10(8)15/h1-5H,6-7H2,(H,16,17,19)
InChI key:InChIKey=NJYFAHBOQWCBEO-UHFFFAOYSA-N
SMILES:C(N1N=C(NC(CCl)=O)C=C1)C2=C(Cl)C=CC=C2F
Synonyms:- Acetamide, 2-chloro-N-[1-[(2-chloro-6-fluorophenyl)methyl]-1H-pyrazol-3-yl]-
- 2-Chloro-N-[1-[(2-chloro-6-fluorophenyl)methyl]-1H-pyrazol-3-yl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.