CAS 1004643-57-5
:5-[(3-Methyl-1H-pyrazol-1-yl)methyl]-1,3,4-oxadiazole-2(3H)-thione
Description:
5-[(3-Methyl-1H-pyrazol-1-yl)methyl]-1,3,4-oxadiazole-2(3H)-thione is a heterocyclic compound characterized by the presence of an oxadiazole ring, which is a five-membered ring containing two nitrogen atoms and three carbon atoms, along with a thione functional group. The compound features a pyrazole moiety, which contributes to its potential biological activity. The methyl group on the pyrazole enhances its lipophilicity, potentially influencing its interaction with biological targets. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structure suggests potential applications in drug development, particularly in areas related to anti-inflammatory or antimicrobial activities. The presence of sulfur in the thione group may also impart unique reactivity and stability characteristics. Overall, this compound's unique structural features and functional groups position it as a candidate for further research in chemical and pharmaceutical applications.
Formula:C7H8N4OS
InChI:InChI=1S/C7H8N4OS/c1-5-2-3-11(10-5)4-6-8-9-7(13)12-6/h2-3H,4H2,1H3,(H,9,13)
InChI key:InChIKey=SAAOPXZRPWGIDA-UHFFFAOYSA-N
SMILES:C(C1=NNC(=S)O1)N2C=CC(C)=N2
Synonyms:- 5-[(3-Methyl-1H-pyrazol-1-yl)methyl]-1,3,4-oxadiazole-2(3H)-thione
- 1,3,4-Oxadiazole-2(3H)-thione, 5-[(3-methyl-1H-pyrazol-1-yl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.