CAS 1004643-75-7

2-(1-Ethyl-1H-pyrazol-4-yl)-4-quinolinecarboxylic acid hydrazide

Description:

2-(1-Ethyl-1H-pyrazol-4-yl)-4-quinolinecarboxylic acid hydrazide is a chemical compound characterized by its unique structural features, which include a quinoline core and a hydrazide functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry and drug development. The presence of the pyrazole moiety may contribute to its pharmacological properties, potentially influencing its interaction with biological targets. Additionally, the hydrazide group can participate in various chemical reactions, including hydrazone formation, which is relevant in the synthesis of more complex molecules. The compound's molecular structure suggests it may possess antioxidant or anti-inflammatory activities, although specific biological activities would require empirical investigation. Overall, 2-(1-Ethyl-1H-pyrazol-4-yl)-4-quinolinecarboxylic acid hydrazide represents a versatile scaffold for further research in the fields of organic and medicinal chemistry.

Formula: C₁₅H₁₅N₅O

InChI: InChI=1S/C15H15N5O/c1-2-20-9-10(8-17-20)14-7-12(15(21)19-16)11-5-3-4-6-13(11)18-14/h3-9H,2,16H2,1H3,(H,19,21)

InChI key: InChIKey=YNRIQIOICXRRQE-UHFFFAOYSA-N

SMILES: C(NN)(=O)C=1C2=C(N=C(C1)C3=CN(CC)N=C3)C=CC=C2

Synonyms:

• 4-Quinolinecarboxylic acid, 2-(1-ethyl-1H-pyrazol-4-yl)-, hydrazide
• 2-(1-Ethyl-1H-pyrazol-4-yl)-4-quinolinecarboxylic acid hydrazide