CAS 1004644-10-3
:Methyl 2-(1-ethyl-3-methyl-1H-pyrazol-4-yl)-4-quinolinecarboxylate
Description:
Methyl 2-(1-ethyl-3-methyl-1H-pyrazol-4-yl)-4-quinolinecarboxylate is a chemical compound characterized by its complex structure, which includes a quinoline moiety and a pyrazole ring. This compound typically exhibits properties associated with both heterocyclic compounds, such as potential biological activity and the ability to participate in various chemical reactions. The presence of the methyl ester functional group suggests it may be soluble in organic solvents and could undergo hydrolysis under certain conditions. Its unique structure may confer specific pharmacological properties, making it of interest in medicinal chemistry for potential applications in drug development. Additionally, the compound's stability, reactivity, and interaction with biological systems would depend on factors such as pH, temperature, and the presence of other chemical species. As with many heterocyclic compounds, it may also exhibit fluorescence or other optical properties, which can be useful in analytical applications. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.
Formula:C17H17N3O2
InChI:InChI=1S/C17H17N3O2/c1-4-20-10-14(11(2)19-20)16-9-13(17(21)22-3)12-7-5-6-8-15(12)18-16/h5-10H,4H2,1-3H3
InChI key:InChIKey=SDOGOVCPSOSHDQ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C2=C(N=C(C1)C3=CN(CC)N=C3C)C=CC=C2
Synonyms:- 4-Quinolinecarboxylic acid, 2-(1-ethyl-3-methyl-1H-pyrazol-4-yl)-, methyl ester
- Methyl 2-(1-ethyl-3-methyl-1H-pyrazol-4-yl)-4-quinolinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.