CymitQuimica logo

CAS 1004644-17-0

:

Methyl 2-(1,5-dimethyl-1H-pyrazol-4-yl)-4-quinolinecarboxylate

Description:
Methyl 2-(1,5-dimethyl-1H-pyrazol-4-yl)-4-quinolinecarboxylate is a chemical compound characterized by its complex structure, which includes a quinoline moiety and a pyrazole ring. This compound typically exhibits properties associated with both heterocyclic compounds, such as potential biological activity and the ability to participate in various chemical reactions. The presence of the methyl ester functional group suggests it may be soluble in organic solvents and could undergo hydrolysis to release the corresponding carboxylic acid. The pyrazole and quinoline components may contribute to its pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound may exhibit fluorescence or other optical properties, depending on its specific electronic structure. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be evaluated for potential applications in drug development or as a chemical probe in biological studies. As with many organic compounds, safety data and handling precautions should be considered due to potential toxicity or reactivity.
Formula:C16H15N3O2
InChI:InChI=1S/C16H15N3O2/c1-10-13(9-17-19(10)2)15-8-12(16(20)21-3)11-6-4-5-7-14(11)18-15/h4-9H,1-3H3
InChI key:InChIKey=RQOYCFGJRILBJH-UHFFFAOYSA-N
SMILES:CC1=C(C=2C=C(C(OC)=O)C3=C(N2)C=CC=C3)C=NN1C
Synonyms:
  • 2-(1,5-Dimethyl-1H-pyrazol-4-yl)-quinoline-4-carboxylic acid methyl ester
  • Methyl 2-(1,5-dimethyl-1H-pyrazol-4-yl)-4-quinolinecarboxylate
  • 4-Quinolinecarboxylic acid, 2-(1,5-dimethyl-1H-pyrazol-4-yl)-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.