CymitQuimica logo

CAS 1004644-18-1

:

3-(Dimethylamino)-1-(1,3,5-trimethyl-1H-pyrazol-4-yl)-2-propen-1-one

Description:
3-(Dimethylamino)-1-(1,3,5-trimethyl-1H-pyrazol-4-yl)-2-propen-1-one, with the CAS number 1004644-18-1, is an organic compound characterized by its unique structural features, including a dimethylamino group and a pyrazole moiety. This compound typically exhibits properties associated with both its functional groups and its conjugated system, which may contribute to its reactivity and potential applications in various fields, such as pharmaceuticals or agrochemicals. The presence of the α,β-unsaturated carbonyl group suggests that it may participate in Michael addition reactions or other nucleophilic attacks. Additionally, the trimethylpyrazole ring can influence the compound's electronic properties and stability. Its solubility, melting point, and boiling point can vary based on the solvent and environmental conditions. Overall, this compound's characteristics make it a subject of interest for further research, particularly in the development of new materials or biologically active agents.
Formula:C11H17N3O
InChI:InChI=1S/C11H17N3O/c1-8-11(9(2)14(5)12-8)10(15)6-7-13(3)4/h6-7H,1-5H3
InChI key:InChIKey=FUYVQGHVVGKFQV-UHFFFAOYSA-N
SMILES:C(C=CN(C)C)(=O)C1=C(C)N(C)N=C1C
Synonyms:
  • 3-(Dimethylamino)-1-(1,3,5-trimethyl-1H-pyrazol-4-yl)-2-propen-1-one
  • 2-Propen-1-one, 3-(dimethylamino)-1-(1,3,5-trimethyl-1H-pyrazol-4-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.