CAS 1004644-25-0

1-Ethyl-3-methyl-5-nitro-1H-pyrazole

Description:

1-Ethyl-3-methyl-5-nitro-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an ethyl group at the first position, a methyl group at the third position, and a nitro group at the fifth position of the pyrazole ring. The presence of the nitro group contributes to its potential reactivity and makes it a candidate for various chemical applications, including as an intermediate in the synthesis of pharmaceuticals or agrochemicals. The compound is likely to exhibit moderate polarity due to the presence of both alkyl groups and the nitro functional group, influencing its solubility in organic solvents. Additionally, the presence of multiple functional groups may impart specific biological activities, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as nitro compounds can be sensitive and may pose health risks. Overall, 1-Ethyl-3-methyl-5-nitro-1H-pyrazole is a compound of interest in both synthetic and applied chemistry contexts.

Formula: C₆H₉N₃O₂

InChI: InChI=1S/C6H9N3O2/c1-3-8-6(9(10)11)4-5(2)7-8/h4H,3H2,1-2H3

InChI key: InChIKey=SCZYYPCEGOVBBU-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1N(CC)N=C(C)C1

Synonyms:

• 1-Ethyl-3-methyl-5-nitro-1H-pyrazole
• 1H-Pyrazole, 1-ethyl-3-methyl-5-nitro-