CAS 1004644-52-3

4-Bromo-5-methyl-1H-pyrazole-1-acetic acid hydrazide

Description:

4-Bromo-5-methyl-1H-pyrazole-1-acetic acid hydrazide is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a bromine atom and a methyl group, along with a hydrazide functional group. This compound typically exhibits properties associated with both pyrazole derivatives and hydrazides, such as potential biological activity, including anti-inflammatory and antimicrobial effects. The presence of the bromine atom can enhance the compound's reactivity and influence its interaction with biological targets. Additionally, the hydrazide moiety may contribute to its ability to form hydrogen bonds, affecting solubility and stability in various solvents. The compound is likely to be of interest in medicinal chemistry and drug development due to its structural features, which may allow for further modifications to optimize its pharmacological properties. As with many chemical substances, safety and handling precautions should be observed, given the potential hazards associated with brominated compounds and hydrazides.

Formula: C₆H₉BrN₄O

InChI: InChI=1S/C6H9BrN4O/c1-4-5(7)2-9-11(4)3-6(12)10-8/h2H,3,8H2,1H3,(H,10,12)

InChI key: InChIKey=RQVZOCPQRISWAJ-UHFFFAOYSA-N

SMILES: C(C(NN)=O)N1C(C)=C(Br)C=N1

Synonyms:

• 1H-Pyrazole-1-acetic acid, 4-bromo-5-methyl-, hydrazide
• 4-Bromo-5-methyl-1H-pyrazole-1-acetic acid hydrazide

2-(4-Bromo-5-methyl-1H-pyrazol-1-yl)acetohydrazide

CAS: 1004644-52-3

Versatile small molecule scaffold

Formula: C₆H₉BrN₄O

Purity: Min. 95%

Molecular weight: 233.07 g/mol

Ref: 3D-EQB64452