CAS 1004644-57-8

3-Methyl-4-nitro-1H-pyrazole-1-propanoic acid hydrazide

Description:

3-Methyl-4-nitro-1H-pyrazole-1-propanoic acid hydrazide is a chemical compound characterized by its unique structure, which includes a pyrazole ring, a nitro group, and a hydrazide functional group. This compound typically exhibits properties associated with both pyrazole derivatives and hydrazides, such as potential biological activity and reactivity. It may be soluble in polar solvents due to the presence of hydrophilic functional groups, while its hydrophobic regions could influence its solubility in non-polar solvents. The nitro group can impart specific electronic properties, making it a candidate for various chemical reactions, including reduction and nucleophilic substitution. Additionally, compounds of this nature are often investigated for their pharmacological properties, including anti-inflammatory or antimicrobial activities. As with many organic compounds, safety data should be consulted to understand its handling, toxicity, and environmental impact. Overall, 3-Methyl-4-nitro-1H-pyrazole-1-propanoic acid hydrazide represents a class of compounds with diverse applications in medicinal chemistry and materials science.

Formula: C₇H₁₁N₅O₃

InChI: InChI=1S/C7H11N5O3/c1-5-6(12(14)15)4-11(10-5)3-2-7(13)9-8/h4H,2-3,8H2,1H3,(H,9,13)

InChI key: InChIKey=ZSTIMXOMZSIUMC-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=CN(CCC(NN)=O)N=C1C

Synonyms:

• 1H-Pyrazole-1-propanoic acid, 3-methyl-4-nitro-, hydrazide
• 3-Methyl-4-nitro-1H-pyrazole-1-propanoic acid hydrazide