CAS 1004644-62-5: 3-Methoxy-4-nitro-1H-pyrazole-1-propanoic acid hydrazide
Description:3-Methoxy-4-nitro-1H-pyrazole-1-propanoic acid hydrazide is a chemical compound characterized by its unique structural features, which include a pyrazole ring, a methoxy group, and a nitro substituent. This compound typically exhibits properties associated with both hydrazides and pyrazoles, such as potential biological activity and reactivity due to the presence of functional groups. The methoxy group can influence its solubility and polarity, while the nitro group may contribute to its reactivity and potential as a pharmacophore in medicinal chemistry. The hydrazide functional group can participate in various chemical reactions, including condensation and hydrazone formation. Additionally, compounds of this type may exhibit interesting pharmacological properties, making them of interest in drug development and research. As with many organic compounds, the specific characteristics such as melting point, boiling point, and spectral data would require empirical determination or reference to literature for precise values. Overall, 3-Methoxy-4-nitro-1H-pyrazole-1-propanoic acid hydrazide represents a versatile structure with potential applications in various fields of chemistry and biology.
Formula:C7H11N5O4
InChI:InChI=1S/C7H11N5O4/c1-16-7-5(12(14)15)4-11(10-7)3-2-6(13)9-8/h4H,2-3,8H2,1H3,(H,9,13)
InChI key:InChIKey=MIQNYJSUOUBBET-UHFFFAOYSA-N
SMILES:O=C(NN)CCN1N=C(OC)C(=C1)N(=O)=O
- Synonyms:
- 1H-Pyrazole-1-propanoic acid, 3-methoxy-4-nitro-, hydrazide
- 3-Methoxy-4-nitro-1H-pyrazole-1-propanoic acid hydrazide
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-(3-Methoxy-4-nitro-1H-pyrazol-1-yl)propionic acid hydrazide REF: 10-F026777CAS: 1004644-62-5 | - - - | - - - | Discontinued product |
![]() | 3-(3-Methoxy-4-nitro-1H-pyrazol-1-yl)propanohydrazide REF: 3D-FM130487CAS: 1004644-62-5 | Min. 95% | - - - | Discontinued product |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
3-(3-Methoxy-4-nitro-1H-pyrazol-1-yl)propionic acid hydrazide
Ref: 10-F026777
1g | Discontinued | Request information | |
2.5g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
3-(3-Methoxy-4-nitro-1H-pyrazol-1-yl)propanohydrazide
Ref: 3D-FM130487
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |