Product correctly added to cart.

3-Methoxy-4-nitro-1H-pyrazole-1-propanoic acid hydrazide

CAS 1004644-62-5: 3-Methoxy-4-nitro-1H-pyrazole-1-propanoic acid hydrazide

Description:3-Methoxy-4-nitro-1H-pyrazole-1-propanoic acid hydrazide is a chemical compound characterized by its unique structural features, which include a pyrazole ring, a methoxy group, and a nitro substituent. This compound typically exhibits properties associated with both hydrazides and pyrazoles, such as potential biological activity and reactivity due to the presence of functional groups. The methoxy group can influence its solubility and polarity, while the nitro group may contribute to its reactivity and potential as a pharmacophore in medicinal chemistry. The hydrazide functional group can participate in various chemical reactions, including condensation and hydrazone formation. Additionally, compounds of this type may exhibit interesting pharmacological properties, making them of interest in drug development and research. As with many organic compounds, the specific characteristics such as melting point, boiling point, and spectral data would require empirical determination or reference to literature for precise values. Overall, 3-Methoxy-4-nitro-1H-pyrazole-1-propanoic acid hydrazide represents a versatile structure with potential applications in various fields of chemistry and biology.

Formula:C7H11N5O4

InChI:InChI=1S/C7H11N5O4/c1-16-7-5(12(14)15)4-11(10-7)3-2-6(13)9-8/h4H,2-3,8H2,1H3,(H,9,13)

InChI key:InChIKey=MIQNYJSUOUBBET-UHFFFAOYSA-N

SMILES:O=C(NN)CCN1N=C(OC)C(=C1)N(=O)=O

  • Synonyms:
  • 1H-Pyrazole-1-propanoic acid, 3-methoxy-4-nitro-, hydrazide
  • 3-Methoxy-4-nitro-1H-pyrazole-1-propanoic acid hydrazide
Sort by


See more categories

This search does not contain any category.

Found 2 products.

discount label

3-(3-Methoxy-4-nitro-1H-pyrazol-1-yl)propanohydrazide

CAS:1004644-62-5

Ref: 3D-FM130487

1gDiscontinuedRequest information
2gDiscontinuedRequest information
100mgDiscontinuedRequest information
250mgDiscontinuedRequest information
500mgDiscontinuedRequest information
Discontinued product
Welcome to CymitQuimica!We use cookies to enhance your visit. We do not include advertising.

Please see our Cookies Policy for more details or adjust your preferences in "Settings".